C17H23N7S — CID 6264891
4,6-dipyrrolidin-1-yl-N-[(E)-1-thiophen-2-ylethylideneamino]-1,3,5-triazin-2-amine (PubChem CID 6264891) has the molecular formula C17H23N7S and a molecular weight of 357.49 g/mol. Its IUPAC name is 4,6-dipyrrolidin-1-yl-N-[(E)-1-thiophen-2-ylethylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dipyrrolidin-1-yl-N-[(E)-1-thiophen-2-ylethylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 6264891 |
| Molecular Formula | C17H23N7S |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4,6-dipyrrolidin-1-yl-N-[(E)-1-thiophen-2-ylethylideneamino]-1,3,5-triazin-2-amine |
| SMILES | C/C(=N\Nc1nc(N2CCCC2)nc(N2CCCC2)n1)c1cccs1 |
| InChI | InChI=1S/C17H23N7S/c1-13(14-7-6-12-25-14)21-22-15-18-16(23-8-2-3-9-23)20-17(19-15)24-10-4-5-11-24/h6-7,12H,2-5,8-11H2,1H3,(H,18,19,20,22)/b21-13+ |
| InChIKey | RLHQMIXIECDQET-FYJGNVAPSA-N |
| XLogP | 2.97 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|