About amino(oxo)methanesulfinate;toluene
amino(oxo)methanesulfinate;toluene (PubChem CID 174496429) has the molecular formula C8H10NO3S-
and a molecular weight of 200.24 g/mol. Its IUPAC name is amino(oxo)methanesulfinate;toluene.
Molecular Properties
| Compound Name | amino(oxo)methanesulfinate;toluene |
| PubChem CID | 174496429 |
| Molecular Formula | C8H10NO3S- |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | amino(oxo)methanesulfinate;toluene |
| SMILES | Cc1ccccc1.NC(=O)S(=O)[O-] |
| InChI | InChI=1S/C7H8.CH3NO3S/c1-7-5-3-2-4-6-7;2-1(3)6(4)5/h2-6H,1H3;(H2,2,3)(H,4,5)/p-1 |
| InChIKey | RCWKSPMGRURSFS-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze amino(oxo)methanesulfinate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(oxo)methanesulfinate;toluene?
The IUPAC name of amino(oxo)methanesulfinate;toluene (CID 174496429) is amino(oxo)methanesulfinate;toluene.
What is the SMILES notation for amino(oxo)methanesulfinate;toluene?
The canonical SMILES for amino(oxo)methanesulfinate;toluene is Cc1ccccc1.NC(=O)S(=O)[O-].
What is the InChIKey of amino(oxo)methanesulfinate;toluene?
The InChIKey is RCWKSPMGRURSFS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8.CH3NO3S/c1-7-5-3-2-4-6-7;2-1(3)6(4)5/h2-6H,1H3;(H2,2,3)(H,4,5)/p-1.
What are the key properties of amino(oxo)methanesulfinate;toluene?
amino(oxo)methanesulfinate;toluene has a molecular weight of 200.24 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino(oxo)methanesulfinate;toluene is sourced from PubChem (CID 174496429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).