C13H8ClNO2 — CID 5118774
3-chloro-N-(4-oxocyclohexa-2,5-dien-1-ylidene)benzamide (PubChem CID 5118774) has the molecular formula C13H8ClNO2 and a molecular weight of 245.67 g/mol. Its IUPAC name is 3-chloro-N-(4-oxocyclohexa-2,5-dien-1-ylidene)benzamide.
| Compound Name | 3-chloro-N-(4-oxocyclohexa-2,5-dien-1-ylidene)benzamide |
|---|---|
| PubChem CID | 5118774 |
| Molecular Formula | C13H8ClNO2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 3-chloro-N-(4-oxocyclohexa-2,5-dien-1-ylidene)benzamide |
| SMILES | O=C1C=CC(=NC(=O)c2cccc(Cl)c2)C=C1 |
| InChI | InChI=1S/C13H8ClNO2/c14-10-3-1-2-9(8-10)13(17)15-11-4-6-12(16)7-5-11/h1-8H |
| InChIKey | ADTWKWGINXXRBJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|