C16H11ClO3 — CID 141466088
1-(2-acetylphenyl)-2-(3-chlorophenyl)ethane-1,2-dione (PubChem CID 141466088) has the molecular formula C16H11ClO3 and a molecular weight of 286.71 g/mol. Its IUPAC name is 1-(2-acetylphenyl)-2-(3-chlorophenyl)ethane-1,2-dione.
| Compound Name | 1-(2-acetylphenyl)-2-(3-chlorophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141466088 |
| Molecular Formula | C16H11ClO3 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-(2-acetylphenyl)-2-(3-chlorophenyl)ethane-1,2-dione |
| SMILES | CC(=O)c1ccccc1C(=O)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClO3/c1-10(18)13-7-2-3-8-14(13)16(20)15(19)11-5-4-6-12(17)9-11/h2-9H,1H3 |
| InChIKey | QHJVIGVRXAFQBB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|