C22H26ClNO2 — CID 15228351
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 4-chlorobenzoate (PubChem CID 15228351) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 4-chlorobenzoate.
| Compound Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 15228351 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 4-chlorobenzoate |
| SMILES | CN(C)Cc1ccc(C2CCC(OC(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClNO2/c1-24(2)15-16-3-5-17(6-4-16)18-9-13-21(14-10-18)26-22(25)19-7-11-20(23)12-8-19/h3-8,11-12,18,21H,9-10,13-15H2,1-2H3 |
| InChIKey | OBJRSXQXGKUMDC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |