C27H35ClN2O3 — CID 54152727
3-[[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]methyl-methylamino]propyl acetate (PubChem CID 54152727) has the molecular formula C27H35ClN2O3 and a molecular weight of 471.04 g/mol. Its IUPAC name is 3-[[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]methyl-methylamino]propyl acetate.
| Compound Name | 3-[[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]methyl-methylamino]propyl acetate |
|---|---|
| PubChem CID | 54152727 |
| Molecular Formula | C27H35ClN2O3 |
| Molecular Weight | 471.04 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-[[4-[4-[(4-chlorobenzoyl)-methylamino]cyclohexyl]phenyl]methyl-methylamino]propyl acetate |
| SMILES | CC(=O)OCCCN(C)Cc1ccc(C2CCC(N(C)C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H35ClN2O3/c1-20(31)33-18-4-17-29(2)19-21-5-7-22(8-6-21)23-11-15-26(16-12-23)30(3)27(32)24-9-13-25(28)14-10-24/h5-10,13-14,23,26H,4,11-12,15-19H2,1-3H3 |
| InChIKey | OIWGXTHEUOWUQD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.04 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|