C28H39N2O3+ — CID 173355810
acetyl-[4-[4-[[3-acetyloxypropyl(methyl)amino]methyl]phenyl]cyclohexyl]-benzylazanium (PubChem CID 173355810) has the molecular formula C28H39N2O3+ and a molecular weight of 451.63 g/mol. Its IUPAC name is acetyl-[4-[4-[[3-acetyloxypropyl(methyl)amino]methyl]phenyl]cyclohexyl]-benzylazanium.
| Compound Name | acetyl-[4-[4-[[3-acetyloxypropyl(methyl)amino]methyl]phenyl]cyclohexyl]-benzylazanium |
|---|---|
| PubChem CID | 173355810 |
| Molecular Formula | C28H39N2O3+ |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | acetyl-[4-[4-[[3-acetyloxypropyl(methyl)amino]methyl]phenyl]cyclohexyl]-benzylazanium |
| SMILES | CC(=O)OCCCN(C)Cc1ccc(C2CCC([NH+](Cc3ccccc3)C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C28H38N2O3/c1-22(31)30(21-24-8-5-4-6-9-24)28-16-14-27(15-17-28)26-12-10-25(11-13-26)20-29(3)18-7-19-33-23(2)32/h4-6,8-13,27-28H,7,14-21H2,1-3H3/p+1 |
| InChIKey | SCMRZCCBAFJJLN-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|