C23H27Cl2NO — CID 19381397
4-chloro-N-[4-[4-(chloromethyl)phenyl]cyclohexyl]-N-propan-2-ylbenzamide (PubChem CID 19381397) has the molecular formula C23H27Cl2NO and a molecular weight of 404.38 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-(chloromethyl)phenyl]cyclohexyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-chloro-N-[4-[4-(chloromethyl)phenyl]cyclohexyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 19381397 |
| Molecular Formula | C23H27Cl2NO |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-chloro-N-[4-[4-(chloromethyl)phenyl]cyclohexyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1ccc(Cl)cc1)C1CCC(c2ccc(CCl)cc2)CC1 |
| InChI | InChI=1S/C23H27Cl2NO/c1-16(2)26(23(27)20-7-11-21(25)12-8-20)22-13-9-19(10-14-22)18-5-3-17(15-24)4-6-18/h3-8,11-12,16,19,22H,9-10,13-15H2,1-2H3 |
| InChIKey | MSVRZXZAXDGLKN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|