C22H33NO2 — CID 15347490
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] cyclohexanecarboxylate (PubChem CID 15347490) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] cyclohexanecarboxylate.
| Compound Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 15347490 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] cyclohexanecarboxylate |
| SMILES | CN(C)Cc1ccc(C2CCC(OC(=O)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H33NO2/c1-23(2)16-17-8-10-18(11-9-17)19-12-14-21(15-13-19)25-22(24)20-6-4-3-5-7-20/h8-11,19-21H,3-7,12-16H2,1-2H3 |
| InChIKey | XNJQDFUHEIZYOR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |