C28H29ClO4 — CID 44513996
[2-[4-(4-chlorophenyl)cyclohexyl]-3,4-dioxonaphthalen-1-yl] hexanoate (PubChem CID 44513996) has the molecular formula C28H29ClO4 and a molecular weight of 464.99 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)cyclohexyl]-3,4-dioxonaphthalen-1-yl] hexanoate.
| Compound Name | [2-[4-(4-chlorophenyl)cyclohexyl]-3,4-dioxonaphthalen-1-yl] hexanoate |
|---|---|
| PubChem CID | 44513996 |
| Molecular Formula | C28H29ClO4 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [2-[4-(4-chlorophenyl)cyclohexyl]-3,4-dioxonaphthalen-1-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1=C(C2CCC(c3ccc(Cl)cc3)CC2)C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H29ClO4/c1-2-3-4-9-24(30)33-28-23-8-6-5-7-22(23)26(31)27(32)25(28)20-12-10-18(11-13-20)19-14-16-21(29)17-15-19/h5-8,14-18,20H,2-4,9-13H2,1H3 |
| InChIKey | OZEIUUYUYRGRDW-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|