C32H37ClO5 — CID 164563526
10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxydecanoic acid (PubChem CID 164563526) has the molecular formula C32H37ClO5 and a molecular weight of 537.10 g/mol. Its IUPAC name is 10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxydecanoic acid.
| Compound Name | 10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxydecanoic acid |
|---|---|
| PubChem CID | 164563526 |
| Molecular Formula | C32H37ClO5 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 10-[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl]oxydecanoic acid |
| SMILES | O=C(O)CCCCCCCCCOC1=C(C2CCC(c3ccc(Cl)cc3)CC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H37ClO5/c33-25-19-17-23(18-20-25)22-13-15-24(16-14-22)29-30(36)26-10-7-8-11-27(26)31(37)32(29)38-21-9-5-3-1-2-4-6-12-28(34)35/h7-8,10-11,17-20,22,24H,1-6,9,12-16,21H2,(H,34,35) |
| InChIKey | KXTFOTAIEKGCJQ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|