C22H21ClO2 — CID 123603138
2-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxy-4H-naphthalen-1-one (PubChem CID 123603138) has the molecular formula C22H21ClO2 and a molecular weight of 352.86 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxy-4H-naphthalen-1-one.
| Compound Name | 2-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxy-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 123603138 |
| Molecular Formula | C22H21ClO2 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxy-4H-naphthalen-1-one |
| SMILES | O=C1C(C2CCC(c3ccc(Cl)cc3)CC2)=CC(O)c2ccccc21 |
| InChI | InChI=1S/C22H21ClO2/c23-17-11-9-15(10-12-17)14-5-7-16(8-6-14)20-13-21(24)18-3-1-2-4-19(18)22(20)25/h1-4,9-14,16,21,24H,5-8H2 |
| InChIKey | OAPNPDPXCUNVFA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |