About 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene
4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene (PubChem CID 174817473) has the molecular formula C20H22Cl2O
and a molecular weight of 349.30 g/mol. Its IUPAC name is 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene |
| PubChem CID | 174817473 |
| Molecular Formula | C20H22Cl2O |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene |
| SMILES | Cc1ccccc1.O=C(Cl)C1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C13H14Cl2O.C7H8/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16;1-7-5-3-2-4-6-7/h5-9,11H,1-4H2;2-6H,1H3 |
| InChIKey | QELVLGAHCHYLRC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene?
The IUPAC name of 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene (CID 174817473) is 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene.
What is the SMILES notation for 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene?
The canonical SMILES for 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene is Cc1ccccc1.O=C(Cl)C1CCC(c2ccc(Cl)cc2)CC1.
What is the InChIKey of 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene?
The InChIKey is QELVLGAHCHYLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O.C7H8/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16;1-7-5-3-2-4-6-7/h5-9,11H,1-4H2;2-6H,1H3.
What are the key properties of 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene?
4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene has a molecular weight of 349.30 g/mol, XLogP of 6.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)cyclohexane-1-carbonyl chloride;toluene is sourced from PubChem (CID 174817473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).