C19H19O2- — CID 4620485
4-(4-phenylphenyl)cyclohexane-1-carboxylate (PubChem CID 4620485) has the molecular formula C19H19O2- and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-(4-phenylphenyl)cyclohexane-1-carboxylate.
| Compound Name | 4-(4-phenylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4620485 |
| Molecular Formula | C19H19O2- |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-(4-phenylphenyl)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1CCC(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C19H20O2/c20-19(21)18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-9,17-18H,10-13H2,(H,20,21)/p-1 |
| InChIKey | LBTWQJBAENCWKC-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |