C22H21ClO3 — CID 142650540
3-[4-(4-chlorophenyl)cyclohexyl]-3-hydroxy-2H-naphthalene-1,4-dione (PubChem CID 142650540) has the molecular formula C22H21ClO3 and a molecular weight of 368.86 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)cyclohexyl]-3-hydroxy-2H-naphthalene-1,4-dione.
| Compound Name | 3-[4-(4-chlorophenyl)cyclohexyl]-3-hydroxy-2H-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 142650540 |
| Molecular Formula | C22H21ClO3 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 3-[4-(4-chlorophenyl)cyclohexyl]-3-hydroxy-2H-naphthalene-1,4-dione |
| SMILES | O=C1CC(O)(C2CCC(c3ccc(Cl)cc3)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H21ClO3/c23-17-11-7-15(8-12-17)14-5-9-16(10-6-14)22(26)13-20(24)18-3-1-2-4-19(18)21(22)25/h1-4,7-8,11-12,14,16,26H,5-6,9-10,13H2 |
| InChIKey | CYBVLOHRSSWNTH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|