C15H8Cl3N — CID 126516412
8-(2,4,6-trichlorophenyl)quinoline (PubChem CID 126516412) has the molecular formula C15H8Cl3N and a molecular weight of 308.60 g/mol. Its IUPAC name is 8-(2,4,6-trichlorophenyl)quinoline.
| Compound Name | 8-(2,4,6-trichlorophenyl)quinoline |
|---|---|
| PubChem CID | 126516412 |
| Molecular Formula | C15H8Cl3N |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 8-(2,4,6-trichlorophenyl)quinoline |
| SMILES | Clc1cc(Cl)c(-c2cccc3cccnc23)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl3N/c16-10-7-12(17)14(13(18)8-10)11-5-1-3-9-4-2-6-19-15(9)11/h1-8H |
| InChIKey | SWAYZPDMWPEFID-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |