C15H11Cl2N3 — CID 102753713
3,5-dichloro-N-methyl-6-quinolin-8-ylpyridin-2-amine (PubChem CID 102753713) has the molecular formula C15H11Cl2N3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 3,5-dichloro-N-methyl-6-quinolin-8-ylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-methyl-6-quinolin-8-ylpyridin-2-amine |
|---|---|
| PubChem CID | 102753713 |
| Molecular Formula | C15H11Cl2N3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3,5-dichloro-N-methyl-6-quinolin-8-ylpyridin-2-amine |
| SMILES | CNc1nc(-c2cccc3cccnc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2N3/c1-18-15-12(17)8-11(16)14(20-15)10-6-2-4-9-5-3-7-19-13(9)10/h2-8H,1H3,(H,18,20) |
| InChIKey | MFAUARUNXKPNSP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |