C13H10ClN — CID 10512877
4-chloro-2-methyl-5H-indeno[1,2-b]pyridine (PubChem CID 10512877) has the molecular formula C13H10ClN and a molecular weight of 215.68 g/mol. Its IUPAC name is 4-chloro-2-methyl-5H-indeno[1,2-b]pyridine.
| Compound Name | 4-chloro-2-methyl-5H-indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 10512877 |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4-chloro-2-methyl-5H-indeno[1,2-b]pyridine |
| SMILES | Cc1cc(Cl)c2c(n1)-c1ccccc1C2 |
| InChI | InChI=1S/C13H10ClN/c1-8-6-12(14)11-7-9-4-2-3-5-10(9)13(11)15-8/h2-6H,7H2,1H3 |
| InChIKey | LJGMVTMMLNTLOB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |