C17H16N2O4 — CID 132573936
diethyl 5H-indeno[1,2-d]pyrimidine-2,4-dicarboxylate (PubChem CID 132573936) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is diethyl 5H-indeno[1,2-d]pyrimidine-2,4-dicarboxylate.
| Compound Name | diethyl 5H-indeno[1,2-d]pyrimidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 132573936 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | diethyl 5H-indeno[1,2-d]pyrimidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c2c(n1)-c1ccccc1C2 |
| InChI | InChI=1S/C17H16N2O4/c1-3-22-16(20)14-12-9-10-7-5-6-8-11(10)13(12)18-15(19-14)17(21)23-4-2/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | CUUFXUCTYOROHN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |