C14H14N2O2 — CID 67354604
3,4-dimethoxy-5H-indeno[1,2-b]pyridin-2-amine (PubChem CID 67354604) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3,4-dimethoxy-5H-indeno[1,2-b]pyridin-2-amine.
| Compound Name | 3,4-dimethoxy-5H-indeno[1,2-b]pyridin-2-amine |
|---|---|
| PubChem CID | 67354604 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3,4-dimethoxy-5H-indeno[1,2-b]pyridin-2-amine |
| SMILES | COc1c(N)nc2c(c1OC)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H14N2O2/c1-17-12-10-7-8-5-3-4-6-9(8)11(10)16-14(15)13(12)18-2/h3-6H,7H2,1-2H3,(H2,15,16) |
| InChIKey | RFXOFOFPADELTH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |