C14H8N2O — CID 175765488
5H-anthra[1,2-c]diazet-10-one (PubChem CID 175765488) has the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. Its IUPAC name is 5H-anthra[1,2-c]diazet-10-one.
| Compound Name | 5H-anthra[1,2-c]diazet-10-one |
|---|---|
| PubChem CID | 175765488 |
| Molecular Formula | C14H8N2O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 5H-anthra[1,2-c]diazet-10-one |
| SMILES | O=C1c2ccccc2Cc2ccc3c(c21)N=N3 |
| InChI | InChI=1S/C14H8N2O/c17-14-10-4-2-1-3-8(10)7-9-5-6-11-13(12(9)14)16-15-11/h1-6H,7H2 |
| InChIKey | UEJNXYRCUJSKFE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |