About 1-nitro-9H-indeno[2,1-c]pyridine
1-nitro-9H-indeno[2,1-c]pyridine (PubChem CID 154332793) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1-nitro-9H-indeno[2,1-c]pyridine.
Molecular Properties
| Compound Name | 1-nitro-9H-indeno[2,1-c]pyridine |
| PubChem CID | 154332793 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-nitro-9H-indeno[2,1-c]pyridine |
| SMILES | O=[N+]([O-])c1nccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C12H8N2O2/c15-14(16)12-11-7-8-3-1-2-4-9(8)10(11)5-6-13-12/h1-6H,7H2 |
| InChIKey | QYLZHVCPBOMEMW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-9H-indeno[2,1-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-9H-indeno[2,1-c]pyridine?
The IUPAC name of 1-nitro-9H-indeno[2,1-c]pyridine (CID 154332793) is 1-nitro-9H-indeno[2,1-c]pyridine.
What is the SMILES notation for 1-nitro-9H-indeno[2,1-c]pyridine?
The canonical SMILES for 1-nitro-9H-indeno[2,1-c]pyridine is O=[N+]([O-])c1nccc2c1Cc1ccccc1-2.
What is the InChIKey of 1-nitro-9H-indeno[2,1-c]pyridine?
The InChIKey is QYLZHVCPBOMEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-14(16)12-11-7-8-3-1-2-4-9(8)10(11)5-6-13-12/h1-6H,7H2.
What are the key properties of 1-nitro-9H-indeno[2,1-c]pyridine?
1-nitro-9H-indeno[2,1-c]pyridine has a molecular weight of 212.21 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-9H-indeno[2,1-c]pyridine is sourced from PubChem (CID 154332793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).