C20H17N3O3 — CID 86714566
7-[[4-(dimethylamino)phenyl]methyl]-12-hydroxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione (PubChem CID 86714566) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 7-[[4-(dimethylamino)phenyl]methyl]-12-hydroxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione.
| Compound Name | 7-[[4-(dimethylamino)phenyl]methyl]-12-hydroxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione |
|---|---|
| PubChem CID | 86714566 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 7-[[4-(dimethylamino)phenyl]methyl]-12-hydroxy-2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaene-6,8-dione |
| SMILES | CN(C)c1ccc(CN2C(=O)c3ccnc4c(O)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C20H17N3O3/c1-22(2)13-5-3-12(4-6-13)11-23-19(25)14-7-8-16(24)18-17(14)15(20(23)26)9-10-21-18/h3-10,24H,11H2,1-2H3 |
| InChIKey | OVZMSMCOZUTAQD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|