C31H34Cl2N4O3 — CID 18727366
1-[4-[[5-(3,4-dichlorophenoxy)-6-methoxy-4-methylquinolin-8-yl]amino]pentyl]-3-(1-phenylethyl)urea (PubChem CID 18727366) has the molecular formula C31H34Cl2N4O3 and a molecular weight of 581.54 g/mol. Its IUPAC name is 1-[4-[[5-(3,4-dichlorophenoxy)-6-methoxy-4-methylquinolin-8-yl]amino]pentyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[4-[[5-(3,4-dichlorophenoxy)-6-methoxy-4-methylquinolin-8-yl]amino]pentyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 18727366 |
| Molecular Formula | C31H34Cl2N4O3 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 1-[4-[[5-(3,4-dichlorophenoxy)-6-methoxy-4-methylquinolin-8-yl]amino]pentyl]-3-(1-phenylethyl)urea |
| SMILES | COc1cc(NC(C)CCCNC(=O)NC(C)c2ccccc2)c2nccc(C)c2c1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H34Cl2N4O3/c1-19-14-16-34-29-26(18-27(39-4)30(28(19)29)40-23-12-13-24(32)25(33)17-23)36-20(2)9-8-15-35-31(38)37-21(3)22-10-6-5-7-11-22/h5-7,10-14,16-18,20-21,36H,8-9,15H2,1-4H3,(H2,35,37,38) |
| InChIKey | RQTBIFPEPVWRLJ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|