C26H45ClN4O2 — CID 90665532
4-N-[4-[(5-butoxy-4-ethyl-6-methoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride (PubChem CID 90665532) has the molecular formula C26H45ClN4O2 and a molecular weight of 481.13 g/mol. Its IUPAC name is 4-N-[4-[(5-butoxy-4-ethyl-6-methoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride.
| Compound Name | 4-N-[4-[(5-butoxy-4-ethyl-6-methoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90665532 |
| Molecular Formula | C26H45ClN4O2 |
| Molecular Weight | 481.13 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 4-N-[4-[(5-butoxy-4-ethyl-6-methoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride |
| SMILES | CCCCOc1c(OC)cc(NC(C)CCCNC(C)CCCN)c2nccc(CC)c12.Cl |
| InChI | InChI=1S/C26H44N4O2.ClH/c1-6-8-17-32-26-23(31-5)18-22(25-24(26)21(7-2)13-16-29-25)30-20(4)12-10-15-28-19(3)11-9-14-27;/h13,16,18-20,28,30H,6-12,14-15,17,27H2,1-5H3;1H |
| InChIKey | JRNXHPBJBPIHIA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.13 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|