C17H25N3O — CID 12529741
4-N-(4-ethyl-6-methoxyquinolin-8-yl)pentane-1,4-diamine (PubChem CID 12529741) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-N-(4-ethyl-6-methoxyquinolin-8-yl)pentane-1,4-diamine.
| Compound Name | 4-N-(4-ethyl-6-methoxyquinolin-8-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 12529741 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 4-N-(4-ethyl-6-methoxyquinolin-8-yl)pentane-1,4-diamine |
| SMILES | CCc1ccnc2c(NC(C)CCCN)cc(OC)cc12 |
| InChI | InChI=1S/C17H25N3O/c1-4-13-7-9-19-17-15(13)10-14(21-3)11-16(17)20-12(2)6-5-8-18/h7,9-12,20H,4-6,8,18H2,1-3H3 |
| InChIKey | KDUINSAEPGRYKZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |