C27H47ClN4O2 — CID 90665534
4-N-[4-[(4-ethyl-6-methoxy-5-pentoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride (PubChem CID 90665534) has the molecular formula C27H47ClN4O2 and a molecular weight of 495.15 g/mol. Its IUPAC name is 4-N-[4-[(4-ethyl-6-methoxy-5-pentoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride.
| Compound Name | 4-N-[4-[(4-ethyl-6-methoxy-5-pentoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90665534 |
| Molecular Formula | C27H47ClN4O2 |
| Molecular Weight | 495.15 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | 4-N-[4-[(4-ethyl-6-methoxy-5-pentoxyquinolin-8-yl)amino]pentyl]pentane-1,4-diamine;hydrochloride |
| SMILES | CCCCCOc1c(OC)cc(NC(C)CCCNC(C)CCCN)c2nccc(CC)c12.Cl |
| InChI | InChI=1S/C27H46N4O2.ClH/c1-6-8-9-18-33-27-24(32-5)19-23(26-25(27)22(7-2)14-17-30-26)31-21(4)13-11-16-29-20(3)12-10-15-28;/h14,17,19-21,29,31H,6-13,15-16,18,28H2,1-5H3;1H |
| InChIKey | NSWYEFOJVGTMNX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.15 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|