C39H47N3O4 — CID 54104970
2-[4-[[6-methoxy-4-methyl-5-(9-phenylnonoxy)quinolin-8-yl]amino]pentyl]isoindole-1,3-dione (PubChem CID 54104970) has the molecular formula C39H47N3O4 and a molecular weight of 621.82 g/mol. Its IUPAC name is 2-[4-[[6-methoxy-4-methyl-5-(9-phenylnonoxy)quinolin-8-yl]amino]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[6-methoxy-4-methyl-5-(9-phenylnonoxy)quinolin-8-yl]amino]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54104970 |
| Molecular Formula | C39H47N3O4 |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | 2-[4-[[6-methoxy-4-methyl-5-(9-phenylnonoxy)quinolin-8-yl]amino]pentyl]isoindole-1,3-dione |
| SMILES | COc1cc(NC(C)CCCN2C(=O)c3ccccc3C2=O)c2nccc(C)c2c1OCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C39H47N3O4/c1-28-23-24-40-36-33(41-29(2)17-16-25-42-38(43)31-21-13-14-22-32(31)39(42)44)27-34(45-3)37(35(28)36)46-26-15-8-6-4-5-7-10-18-30-19-11-9-12-20-30/h9,11-14,19-24,27,29,41H,4-8,10,15-18,25-26H2,1-3H3 |
| InChIKey | NDCNJLAEZZNGMR-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|