C25H28N2O6 — CID 67841467
[acetyloxy-[4-[7-(1,3-dioxoisoindol-2-yl)heptyl]-2-pyridinyl]methyl] acetate (PubChem CID 67841467) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is [acetyloxy-[4-[7-(1,3-dioxoisoindol-2-yl)heptyl]-2-pyridinyl]methyl] acetate.
| Compound Name | [acetyloxy-[4-[7-(1,3-dioxoisoindol-2-yl)heptyl]-2-pyridinyl]methyl] acetate |
|---|---|
| PubChem CID | 67841467 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [acetyloxy-[4-[7-(1,3-dioxoisoindol-2-yl)heptyl]-2-pyridinyl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)c1cc(CCCCCCCN2C(=O)c3ccccc3C2=O)ccn1 |
| InChI | InChI=1S/C25H28N2O6/c1-17(28)32-25(33-18(2)29)22-16-19(13-14-26-22)10-6-4-3-5-9-15-27-23(30)20-11-7-8-12-21(20)24(27)31/h7-8,11-14,16,25H,3-6,9-10,15H2,1-2H3 |
| InChIKey | GIIITGUQKFHCIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|