C20H19NO4 — CID 67846447
[1,3-dioxo-2-(4-phenylbutyl)isoindol-4-yl] acetate (PubChem CID 67846447) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is [1,3-dioxo-2-(4-phenylbutyl)isoindol-4-yl] acetate.
| Compound Name | [1,3-dioxo-2-(4-phenylbutyl)isoindol-4-yl] acetate |
|---|---|
| PubChem CID | 67846447 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [1,3-dioxo-2-(4-phenylbutyl)isoindol-4-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)N(CCCCc1ccccc1)C2=O |
| InChI | InChI=1S/C20H19NO4/c1-14(22)25-17-12-7-11-16-18(17)20(24)21(19(16)23)13-6-5-10-15-8-3-2-4-9-15/h2-4,7-9,11-12H,5-6,10,13H2,1H3 |
| InChIKey | FJOCGKSUELQONU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|