C24H25N3O3 — CID 45028330
2-[4-[(6-methoxyquinolin-8-yl)amino]hexyl]isoindole-1,3-dione (PubChem CID 45028330) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[4-[(6-methoxyquinolin-8-yl)amino]hexyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(6-methoxyquinolin-8-yl)amino]hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45028330 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[4-[(6-methoxyquinolin-8-yl)amino]hexyl]isoindole-1,3-dione |
| SMILES | CCC(CCCN1C(=O)c2ccccc2C1=O)Nc1cc(OC)cc2cccnc12 |
| InChI | InChI=1S/C24H25N3O3/c1-3-17(26-21-15-18(30-2)14-16-8-6-12-25-22(16)21)9-7-13-27-23(28)19-10-4-5-11-20(19)24(27)29/h4-6,8,10-12,14-15,17,26H,3,7,9,13H2,1-2H3 |
| InChIKey | GQGKXNNGVJUVEO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|