C33H37N3O3 — CID 69304996
2-[4-[[2-(1-adamantyl)-6-methoxyquinolin-8-yl]amino]pentyl]isoindole-1,3-dione (PubChem CID 69304996) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[4-[[2-(1-adamantyl)-6-methoxyquinolin-8-yl]amino]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[2-(1-adamantyl)-6-methoxyquinolin-8-yl]amino]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69304996 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 2-[4-[[2-(1-adamantyl)-6-methoxyquinolin-8-yl]amino]pentyl]isoindole-1,3-dione |
| SMILES | COc1cc(NC(C)CCCN2C(=O)c3ccccc3C2=O)c2nc(C34CC5CC(CC(C5)C3)C4)ccc2c1 |
| InChI | InChI=1S/C33H37N3O3/c1-20(6-5-11-36-31(37)26-7-3-4-8-27(26)32(36)38)34-28-16-25(39-2)15-24-9-10-29(35-30(24)28)33-17-21-12-22(18-33)14-23(13-21)19-33/h3-4,7-10,15-16,20-23,34H,5-6,11-14,17-19H2,1-2H3 |
| InChIKey | BOSYHWYSHOPEJW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|