C25H37N3O6 — CID 70478090
but-2-enedioic acid;4-N-(6-methoxy-4-methyl-5-pentoxyquinolin-8-yl)pentane-1,4-diamine (PubChem CID 70478090) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is but-2-enedioic acid;4-N-(6-methoxy-4-methyl-5-pentoxyquinolin-8-yl)pentane-1,4-diamine.
| Compound Name | but-2-enedioic acid;4-N-(6-methoxy-4-methyl-5-pentoxyquinolin-8-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 70478090 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | but-2-enedioic acid;4-N-(6-methoxy-4-methyl-5-pentoxyquinolin-8-yl)pentane-1,4-diamine |
| SMILES | CCCCCOc1c(OC)cc(NC(C)CCCN)c2nccc(C)c12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H33N3O2.C4H4O4/c1-5-6-7-13-26-21-18(25-4)14-17(24-16(3)9-8-11-22)20-19(21)15(2)10-12-23-20;5-3(6)1-2-4(7)8/h10,12,14,16,24H,5-9,11,13,22H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | NRNVBRRFLAUZTE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|