C22H31N3O6 — CID 70478311
but-2-enedioic acid;4-N-(6-methoxy-5-propoxyquinolin-8-yl)pentane-1,4-diamine (PubChem CID 70478311) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is but-2-enedioic acid;4-N-(6-methoxy-5-propoxyquinolin-8-yl)pentane-1,4-diamine.
| Compound Name | but-2-enedioic acid;4-N-(6-methoxy-5-propoxyquinolin-8-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 70478311 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | but-2-enedioic acid;4-N-(6-methoxy-5-propoxyquinolin-8-yl)pentane-1,4-diamine |
| SMILES | CCCOc1c(OC)cc(NC(C)CCCN)c2ncccc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H27N3O2.C4H4O4/c1-4-11-23-18-14-8-6-10-20-17(14)15(12-16(18)22-3)21-13(2)7-5-9-19;5-3(6)1-2-4(7)8/h6,8,10,12-13,21H,4-5,7,9,11,19H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | NYWUESHISUXHQW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|