C22H35N3O — CID 12529748
N',N'-diethyl-N-(4-ethyl-6-methoxyquinolin-8-yl)hexane-1,6-diamine (PubChem CID 12529748) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is N',N'-diethyl-N-(4-ethyl-6-methoxyquinolin-8-yl)hexane-1,6-diamine.
| Compound Name | N',N'-diethyl-N-(4-ethyl-6-methoxyquinolin-8-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 12529748 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | N',N'-diethyl-N-(4-ethyl-6-methoxyquinolin-8-yl)hexane-1,6-diamine |
| SMILES | CCc1ccnc2c(NCCCCCCN(CC)CC)cc(OC)cc12 |
| InChI | InChI=1S/C22H35N3O/c1-5-18-12-14-24-22-20(18)16-19(26-4)17-21(22)23-13-10-8-9-11-15-25(6-2)7-3/h12,14,16-17,23H,5-11,13,15H2,1-4H3 |
| InChIKey | PNLVMSIROMOKRO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|