C18H29I2N3O2 — CID 131880882
N-(2,6-dimethoxyquinolin-8-yl)-N',N'-diethylpropane-1,3-diamine;dihydroiodide (PubChem CID 131880882) has the molecular formula C18H29I2N3O2 and a molecular weight of 573.26 g/mol. Its IUPAC name is N-(2,6-dimethoxyquinolin-8-yl)-N',N'-diethylpropane-1,3-diamine;dihydroiodide.
| Compound Name | N-(2,6-dimethoxyquinolin-8-yl)-N',N'-diethylpropane-1,3-diamine;dihydroiodide |
|---|---|
| PubChem CID | 131880882 |
| Molecular Formula | C18H29I2N3O2 |
| Molecular Weight | 573.26 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | N-(2,6-dimethoxyquinolin-8-yl)-N',N'-diethylpropane-1,3-diamine;dihydroiodide |
| SMILES | CCN(CC)CCCNc1cc(OC)cc2ccc(OC)nc12.I.I |
| InChI | InChI=1S/C18H27N3O2.2HI/c1-5-21(6-2)11-7-10-19-16-13-15(22-3)12-14-8-9-17(23-4)20-18(14)16;;/h8-9,12-13,19H,5-7,10-11H2,1-4H3;2*1H |
| InChIKey | UYLYUFNADYFMMR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|