C21H28N5O3- — CID 21142753
N-[9-amino-1-[3-(diethylamino)propylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine (PubChem CID 21142753) has the molecular formula C21H28N5O3- and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[9-amino-1-[3-(diethylamino)propylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine.
| Compound Name | N-[9-amino-1-[3-(diethylamino)propylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 21142753 |
| Molecular Formula | C21H28N5O3- |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-[9-amino-1-[3-(diethylamino)propylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine |
| SMILES | CCN(CC)CCCNc1ccc(N([O-])O)c2nc3ccc(OC)cc3c(N)c12 |
| InChI | InChI=1S/C21H28N5O3/c1-4-25(5-2)12-6-11-23-17-9-10-18(26(27)28)21-19(17)20(22)15-13-14(29-3)7-8-16(15)24-21/h7-10,13,23,27H,4-6,11-12H2,1-3H3,(H2,22,24)/q-1 |
| InChIKey | FJIOKNRSLJGWSK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|