C22H31N6O3- — CID 21142739
N-[1,9-bis[2-(dimethylamino)ethylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine (PubChem CID 21142739) has the molecular formula C22H31N6O3- and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[1,9-bis[2-(dimethylamino)ethylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine.
| Compound Name | N-[1,9-bis[2-(dimethylamino)ethylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 21142739 |
| Molecular Formula | C22H31N6O3- |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[1,9-bis[2-(dimethylamino)ethylamino]-7-methoxyacridin-4-yl]-N-oxidohydroxylamine |
| SMILES | COc1ccc2nc3c(N([O-])O)ccc(NCCN(C)C)c3c(NCCN(C)C)c2c1 |
| InChI | InChI=1S/C22H31N6O3/c1-26(2)12-10-23-18-8-9-19(28(29)30)22-20(18)21(24-11-13-27(3)4)16-14-15(31-5)6-7-17(16)25-22/h6-9,14,23,29H,10-13H2,1-5H3,(H,24,25)/q-1 |
| InChIKey | OVEWCKYNABCXNU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|