C20H23N3O5 — CID 10156910
N-hydroxy-7-methoxy-4-methyl-9-(2-propanoyloxyethylamino)acridin-1-amine oxide (PubChem CID 10156910) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-hydroxy-7-methoxy-4-methyl-9-(2-propanoyloxyethylamino)acridin-1-amine oxide.
| Compound Name | N-hydroxy-7-methoxy-4-methyl-9-(2-propanoyloxyethylamino)acridin-1-amine oxide |
|---|---|
| PubChem CID | 10156910 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-hydroxy-7-methoxy-4-methyl-9-(2-propanoyloxyethylamino)acridin-1-amine oxide |
| SMILES | CCC(=O)OCCNc1c2cc(OC)ccc2nc2c(C)ccc([NH+]([O-])O)c12 |
| InChI | InChI=1S/C20H23N3O5/c1-4-17(24)28-10-9-21-20-14-11-13(27-3)6-7-15(14)22-19-12(2)5-8-16(18(19)20)23(25)26/h5-8,11,23,25H,4,9-10H2,1-3H3,(H,21,22) |
| InChIKey | PAEZFGMNOQAQTC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|