C19H25ClN4O2 — CID 21122674
9-[3-(dimethylamino)propylamino]-N-hydroxy-4-methylacridin-1-amine oxide;hydrochloride (PubChem CID 21122674) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 9-[3-(dimethylamino)propylamino]-N-hydroxy-4-methylacridin-1-amine oxide;hydrochloride.
| Compound Name | 9-[3-(dimethylamino)propylamino]-N-hydroxy-4-methylacridin-1-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 21122674 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 9-[3-(dimethylamino)propylamino]-N-hydroxy-4-methylacridin-1-amine oxide;hydrochloride |
| SMILES | Cc1ccc([NH+]([O-])O)c2c(NCCCN(C)C)c3ccccc3nc12.Cl |
| InChI | InChI=1S/C19H24N4O2.ClH/c1-13-9-10-16(23(24)25)17-18(13)21-15-8-5-4-7-14(15)19(17)20-11-6-12-22(2)3;/h4-5,7-10,23-24H,6,11-12H2,1-3H3,(H,20,21);1H |
| InChIKey | RSEIMFGLCRQMNF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|