C16H18N4O2 — CID 21142837
9-(3-aminopropylamino)-N-hydroxyacridin-1-amine oxide (PubChem CID 21142837) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 9-(3-aminopropylamino)-N-hydroxyacridin-1-amine oxide.
| Compound Name | 9-(3-aminopropylamino)-N-hydroxyacridin-1-amine oxide |
|---|---|
| PubChem CID | 21142837 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 9-(3-aminopropylamino)-N-hydroxyacridin-1-amine oxide |
| SMILES | NCCCNc1c2ccccc2nc2cccc([NH+]([O-])O)c12 |
| InChI | InChI=1S/C16H18N4O2/c17-9-4-10-18-16-11-5-1-2-6-12(11)19-13-7-3-8-14(15(13)16)20(21)22/h1-3,5-8,20-21H,4,9-10,17H2,(H,18,19) |
| InChIKey | OQEWMEZLGWVZFS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|