C21H28N4O6S — CID 21143004
N-hydroxy-9-(3-morpholin-4-ylpropylamino)acridin-1-amine oxide;methanesulfonic acid (PubChem CID 21143004) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is N-hydroxy-9-(3-morpholin-4-ylpropylamino)acridin-1-amine oxide;methanesulfonic acid.
| Compound Name | N-hydroxy-9-(3-morpholin-4-ylpropylamino)acridin-1-amine oxide;methanesulfonic acid |
|---|---|
| PubChem CID | 21143004 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-hydroxy-9-(3-morpholin-4-ylpropylamino)acridin-1-amine oxide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[O-][NH+](O)c1cccc2nc3ccccc3c(NCCCN3CCOCC3)c12 |
| InChI | InChI=1S/C20H24N4O3.CH4O3S/c25-24(26)18-8-3-7-17-19(18)20(15-5-1-2-6-16(15)22-17)21-9-4-10-23-11-13-27-14-12-23;1-5(2,3)4/h1-3,5-8,24-25H,4,9-14H2,(H,21,22);1H3,(H,2,3,4) |
| InChIKey | ZMXSIVUFJHSLKD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 139.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|