C26H39N3O — CID 54768920
N-(9-morpholin-4-ylnonyl)-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 54768920) has the molecular formula C26H39N3O and a molecular weight of 409.62 g/mol. Its IUPAC name is N-(9-morpholin-4-ylnonyl)-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-(9-morpholin-4-ylnonyl)-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 54768920 |
| Molecular Formula | C26H39N3O |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | N-(9-morpholin-4-ylnonyl)-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | c1ccc2c(NCCCCCCCCCN3CCOCC3)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C26H39N3O/c1(3-5-11-17-29-18-20-30-21-19-29)2-4-10-16-27-26-22-12-6-8-14-24(22)28-25-15-9-7-13-23(25)26/h6,8,12,14H,1-5,7,9-11,13,15-21H2,(H,27,28) |
| InChIKey | PWPZNYJSIAPFAS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|