C17H17N3O5 — CID 21142831
9-(2-carboxyethylamino)-N-hydroxy-7-methoxyacridin-1-amine oxide (PubChem CID 21142831) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 9-(2-carboxyethylamino)-N-hydroxy-7-methoxyacridin-1-amine oxide.
| Compound Name | 9-(2-carboxyethylamino)-N-hydroxy-7-methoxyacridin-1-amine oxide |
|---|---|
| PubChem CID | 21142831 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 9-(2-carboxyethylamino)-N-hydroxy-7-methoxyacridin-1-amine oxide |
| SMILES | COc1ccc2nc3cccc([NH+]([O-])O)c3c(NCCC(=O)O)c2c1 |
| InChI | InChI=1S/C17H17N3O5/c1-25-10-5-6-12-11(9-10)17(18-8-7-15(21)22)16-13(19-12)3-2-4-14(16)20(23)24/h2-6,9,20,23H,7-8H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | BZXNTLQTVQIAFR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|