C26H40N6O3 — CID 21142740
1,9-bis[2-(diethylamino)ethylamino]-N-hydroxy-7-methoxyacridin-4-amine oxide (PubChem CID 21142740) has the molecular formula C26H40N6O3 and a molecular weight of 484.65 g/mol. Its IUPAC name is 1,9-bis[2-(diethylamino)ethylamino]-N-hydroxy-7-methoxyacridin-4-amine oxide.
| Compound Name | 1,9-bis[2-(diethylamino)ethylamino]-N-hydroxy-7-methoxyacridin-4-amine oxide |
|---|---|
| PubChem CID | 21142740 |
| Molecular Formula | C26H40N6O3 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 1,9-bis[2-(diethylamino)ethylamino]-N-hydroxy-7-methoxyacridin-4-amine oxide |
| SMILES | CCN(CC)CCNc1ccc([NH+]([O-])O)c2nc3ccc(OC)cc3c(NCCN(CC)CC)c12 |
| InChI | InChI=1S/C26H40N6O3/c1-6-30(7-2)16-14-27-22-12-13-23(32(33)34)26-24(22)25(28-15-17-31(8-3)9-4)20-18-19(35-5)10-11-21(20)29-26/h10-13,18,27,32-33H,6-9,14-17H2,1-5H3,(H,28,29) |
| InChIKey | RTSWXEZZSZGSQV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|