C24H33ClN6O2S — CID 21143832
14,16-bis[3-(dimethylamino)propyl]-N-hydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-amine oxide;hydrochloride (PubChem CID 21143832) has the molecular formula C24H33ClN6O2S and a molecular weight of 505.09 g/mol. Its IUPAC name is 14,16-bis[3-(dimethylamino)propyl]-N-hydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-amine oxide;hydrochloride.
| Compound Name | 14,16-bis[3-(dimethylamino)propyl]-N-hydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 21143832 |
| Molecular Formula | C24H33ClN6O2S |
| Molecular Weight | 505.09 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 14,16-bis[3-(dimethylamino)propyl]-N-hydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-amine oxide;hydrochloride |
| SMILES | CN(C)CCCN1C(=S)N(CCCN(C)C)c2c3ccccc3nc3c([NH+]([O-])O)ccc1c23.Cl |
| InChI | InChI=1S/C24H32N6O2S.ClH/c1-26(2)13-7-15-28-19-11-12-20(30(31)32)22-21(19)23(17-9-5-6-10-18(17)25-22)29(24(28)33)16-8-14-27(3)4;/h5-6,9-12,30-31H,7-8,13-16H2,1-4H3;1H |
| InChIKey | LPVLYFOPXRYDCR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|