C24H33ClN6O3S — CID 21144004
14,16-bis[3-(dimethylamino)propyl]-N,4-dihydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-10-amine oxide;hydrochloride (PubChem CID 21144004) has the molecular formula C24H33ClN6O3S and a molecular weight of 521.09 g/mol. Its IUPAC name is 14,16-bis[3-(dimethylamino)propyl]-N,4-dihydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-10-amine oxide;hydrochloride.
| Compound Name | 14,16-bis[3-(dimethylamino)propyl]-N,4-dihydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-10-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 21144004 |
| Molecular Formula | C24H33ClN6O3S |
| Molecular Weight | 521.09 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 14,16-bis[3-(dimethylamino)propyl]-N,4-dihydroxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-10-amine oxide;hydrochloride |
| SMILES | CN(C)CCCN1C(=S)N(CCCN(C)C)c2c3cc(O)ccc3nc3c([NH+]([O-])O)ccc1c23.Cl |
| InChI | InChI=1S/C24H32N6O3S.ClH/c1-26(2)11-5-13-28-19-9-10-20(30(32)33)22-21(19)23(17-15-16(31)7-8-18(17)25-22)29(24(28)34)14-6-12-27(3)4;/h7-10,15,30-32H,5-6,11-14H2,1-4H3;1H |
| InChIKey | CYVBTXNBIBDLSX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|