C20H24ClN5O3S — CID 135801326
14-[3-(dimethylamino)propyl]-N-hydroxy-4-methoxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride (PubChem CID 135801326) has the molecular formula C20H24ClN5O3S and a molecular weight of 449.96 g/mol. Its IUPAC name is 14-[3-(dimethylamino)propyl]-N-hydroxy-4-methoxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride.
| Compound Name | 14-[3-(dimethylamino)propyl]-N-hydroxy-4-methoxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride |
|---|---|
| PubChem CID | 135801326 |
| Molecular Formula | C20H24ClN5O3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 14-[3-(dimethylamino)propyl]-N-hydroxy-4-methoxy-15-sulfanylidene-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-10-amine oxide;hydrochloride |
| SMILES | COc1ccc2c(c1)-c1nc(=S)n(CCCN(C)C)c3ccc([NH+]([O-])O)c(c13)N2.Cl |
| InChI | InChI=1S/C20H23N5O3S.ClH/c1-23(2)9-4-10-24-15-7-8-16(25(26)27)19-17(15)18(22-20(24)29)13-11-12(28-3)5-6-14(13)21-19;/h5-8,11,21,25-26H,4,9-10H2,1-3H3;1H |
| InChIKey | BXUNGVJJFBSSLM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|