C18H20N2S — CID 3015682
3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine (PubChem CID 3015682) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 3015682 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCSc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C18H20N2S/c1-20(2)12-7-13-21-18-14-8-3-5-10-16(14)19-17-11-6-4-9-15(17)18/h3-6,8-11H,7,12-13H2,1-2H3 |
| InChIKey | QHTMMEHAKNEUFA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|