About 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine
3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine (PubChem CID 3015682) has the molecular formula C18H20N2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine |
| PubChem CID | 3015682 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCSc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C18H20N2S/c1-20(2)12-7-13-21-18-14-8-3-5-10-16(14)19-17-11-6-4-9-15(17)18/h3-6,8-11H,7,12-13H2,1-2H3 |
| InChIKey | QHTMMEHAKNEUFA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine (CID 3015682) is 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine is CN(C)CCCSc1c2ccccc2nc2ccccc12.
What is the InChIKey of 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine?
The InChIKey is QHTMMEHAKNEUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2S/c1-20(2)12-7-13-21-18-14-8-3-5-10-16(14)19-17-11-6-4-9-15(17)18/h3-6,8-11H,7,12-13H2,1-2H3.
What are the key properties of 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine?
3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine has a molecular weight of 296.44 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acridin-9-ylsulfanyl-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 3015682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).