C21H26IN3O2 — CID 54604172
N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;hydroiodide (PubChem CID 54604172) has the molecular formula C21H26IN3O2 and a molecular weight of 479.36 g/mol. Its IUPAC name is N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;hydroiodide.
| Compound Name | N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;hydroiodide |
|---|---|
| PubChem CID | 54604172 |
| Molecular Formula | C21H26IN3O2 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N'-(6-ethoxy-2-phenylmethoxyquinolin-8-yl)propane-1,3-diamine;hydroiodide |
| SMILES | CCOc1cc(NCCCN)c2nc(OCc3ccccc3)ccc2c1.I |
| InChI | InChI=1S/C21H25N3O2.HI/c1-2-25-18-13-17-9-10-20(26-15-16-7-4-3-5-8-16)24-21(17)19(14-18)23-12-6-11-22;/h3-5,7-10,13-14,23H,2,6,11-12,15,22H2,1H3;1H |
| InChIKey | BNQOCRUTFIPLSB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|